About 2,5-dibromohexoxybenzene
2,5-dibromohexoxybenzene (PubChem CID 173161444) has the molecular formula C12H16Br2O
and a molecular weight of 336.07 g/mol. Its IUPAC name is 2,5-dibromohexoxybenzene.
Molecular Properties
| Compound Name | 2,5-dibromohexoxybenzene |
| PubChem CID | 173161444 |
| Molecular Formula | C12H16Br2O |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 2,5-dibromohexoxybenzene |
| SMILES | CC(Br)CCC(Br)COc1ccccc1 |
| InChI | InChI=1S/C12H16Br2O/c1-10(13)7-8-11(14)9-15-12-5-3-2-4-6-12/h2-6,10-11H,7-9H2,1H3 |
| InChIKey | WOVSYNHITDXGBC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromohexoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromohexoxybenzene?
The IUPAC name of 2,5-dibromohexoxybenzene (CID 173161444) is 2,5-dibromohexoxybenzene.
What is the SMILES notation for 2,5-dibromohexoxybenzene?
The canonical SMILES for 2,5-dibromohexoxybenzene is CC(Br)CCC(Br)COc1ccccc1.
What is the InChIKey of 2,5-dibromohexoxybenzene?
The InChIKey is WOVSYNHITDXGBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Br2O/c1-10(13)7-8-11(14)9-15-12-5-3-2-4-6-12/h2-6,10-11H,7-9H2,1H3.
What are the key properties of 2,5-dibromohexoxybenzene?
2,5-dibromohexoxybenzene has a molecular weight of 336.07 g/mol, XLogP of 4.39, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromohexoxybenzene is sourced from PubChem (CID 173161444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).