C14H24O2 — CID 162239037
3,3-dimethyl-1-phenoxybutan-2-ol;ethane (PubChem CID 162239037) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenoxybutan-2-ol;ethane.
| Compound Name | 3,3-dimethyl-1-phenoxybutan-2-ol;ethane |
|---|---|
| PubChem CID | 162239037 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3,3-dimethyl-1-phenoxybutan-2-ol;ethane |
| SMILES | CC.CC(C)(C)C(O)COc1ccccc1 |
| InChI | InChI=1S/C12H18O2.C2H6/c1-12(2,3)11(13)9-14-10-7-5-4-6-8-10;1-2/h4-8,11,13H,9H2,1-3H3;1-2H3 |
| InChIKey | ZWLKWAKUHUBGRK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |