C16H21NO2 — CID 57262267
3,3-dimethyl-1-phenoxy-4-(1H-pyrrol-2-yl)butan-2-ol (PubChem CID 57262267) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenoxy-4-(1H-pyrrol-2-yl)butan-2-ol.
| Compound Name | 3,3-dimethyl-1-phenoxy-4-(1H-pyrrol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 57262267 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 3,3-dimethyl-1-phenoxy-4-(1H-pyrrol-2-yl)butan-2-ol |
| SMILES | CC(C)(Cc1ccc[nH]1)C(O)COc1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c1-16(2,11-13-7-6-10-17-13)15(18)12-19-14-8-4-3-5-9-14/h3-10,15,17-18H,11-12H2,1-2H3 |
| InChIKey | RNIXVCWGYCBMJF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |