C20H22O4 — CID 14026776
(3Z,5Z)-1,8-diphenoxyocta-3,5-diene-2,7-diol (PubChem CID 14026776) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (3Z,5Z)-1,8-diphenoxyocta-3,5-diene-2,7-diol.
| Compound Name | (3Z,5Z)-1,8-diphenoxyocta-3,5-diene-2,7-diol |
|---|---|
| PubChem CID | 14026776 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3Z,5Z)-1,8-diphenoxyocta-3,5-diene-2,7-diol |
| SMILES | OC(/C=C\C=C/C(O)COc1ccccc1)COc1ccccc1 |
| InChI | InChI=1S/C20H22O4/c21-17(15-23-19-11-3-1-4-12-19)9-7-8-10-18(22)16-24-20-13-5-2-6-14-20/h1-14,17-18,21-22H,15-16H2/b9-7-,10-8- |
| InChIKey | FFOJVMCKYUHVAD-XOHWUJONSA-N |
| XLogP | 2.98 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|