C20H28O3 — CID 167222940
(11E,13R)-13-hydroxy-14-phenoxytetradeca-1,11-dien-3-one (PubChem CID 167222940) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (11E,13R)-13-hydroxy-14-phenoxytetradeca-1,11-dien-3-one.
| Compound Name | (11E,13R)-13-hydroxy-14-phenoxytetradeca-1,11-dien-3-one |
|---|---|
| PubChem CID | 167222940 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (11E,13R)-13-hydroxy-14-phenoxytetradeca-1,11-dien-3-one |
| SMILES | C=CC(=O)CCCCCCC/C=C/[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C20H28O3/c1-2-18(21)13-9-6-4-3-5-7-10-14-19(22)17-23-20-15-11-8-12-16-20/h2,8,10-12,14-16,19,22H,1,3-7,9,13,17H2/b14-10+/t19-/m1/s1 |
| InChIKey | MHPDTALSDSPDSF-NRJHKNTJSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|