C19H24O5 — CID 88681398
(6Z,8E,10E)-5,12-dihydroxy-13-phenoxytrideca-6,8,10-trienoic acid (PubChem CID 88681398) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (6Z,8E,10E)-5,12-dihydroxy-13-phenoxytrideca-6,8,10-trienoic acid.
| Compound Name | (6Z,8E,10E)-5,12-dihydroxy-13-phenoxytrideca-6,8,10-trienoic acid |
|---|---|
| PubChem CID | 88681398 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (6Z,8E,10E)-5,12-dihydroxy-13-phenoxytrideca-6,8,10-trienoic acid |
| SMILES | O=C(O)CCCC(O)/C=C\C=C\C=C\C(O)COc1ccccc1 |
| InChI | InChI=1S/C19H24O5/c20-16(11-8-14-19(22)23)9-4-1-2-5-10-17(21)15-24-18-12-6-3-7-13-18/h1-7,9-10,12-13,16-17,20-21H,8,11,14-15H2,(H,22,23)/b2-1+,9-4-,10-5+ |
| InChIKey | DOVDCYFKZXTYCB-PPAMGLIUSA-N |
| XLogP | 2.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|