C21H25FO7 — CID 90834831
2-[(2S,3R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetic acid (PubChem CID 90834831) has the molecular formula C21H25FO7 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[(2S,3R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetic acid.
| Compound Name | 2-[(2S,3R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetic acid |
|---|---|
| PubChem CID | 90834831 |
| Molecular Formula | C21H25FO7 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[(2S,3R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetic acid |
| SMILES | O=C(O)COC[C@H](O)[C@H](O)C=CC=CC=CC=CC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FO7/c22-16-9-11-18(12-10-16)29-13-17(23)7-5-3-1-2-4-6-8-19(24)20(25)14-28-15-21(26)27/h1-12,17,19-20,23-25H,13-15H2,(H,26,27)/t17?,19-,20+/m1/s1 |
| InChIKey | HFBOHZRZTBPMPU-GQXIWKRZSA-N |
| XLogP | 1.61 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|