C22H25FO7 — CID 10287862
methyl 2-[(2S,3S,4E,6E,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate (PubChem CID 10287862) has the molecular formula C22H25FO7 and a molecular weight of 420.43 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4E,6E,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate.
| Compound Name | methyl 2-[(2S,3S,4E,6E,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate |
|---|---|
| PubChem CID | 10287862 |
| Molecular Formula | C22H25FO7 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | methyl 2-[(2S,3S,4E,6E,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate |
| SMILES | COC(=O)COC[C@H](O)[C@@H](O)/C=C/C=C/C#C/C=C/[C@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FO7/c1-28-22(27)16-29-15-21(26)20(25)9-7-5-3-2-4-6-8-18(24)14-30-19-12-10-17(23)11-13-19/h3,5-13,18,20-21,24-26H,14-16H2,1H3/b5-3+,8-6+,9-7+/t18-,20-,21-/m0/s1 |
| InChIKey | XUFOJLMXNBOLPC-GKNXXXRQSA-N |
| XLogP | 1.15 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|