C21H24FKO7 — CID 173132931
potassium;2-[(2R,3S,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid;hydride (PubChem CID 173132931) has the molecular formula C21H24FKO7 and a molecular weight of 446.51 g/mol. Its IUPAC name is potassium;2-[(2R,3S,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid;hydride.
| Compound Name | potassium;2-[(2R,3S,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid;hydride |
|---|---|
| PubChem CID | 173132931 |
| Molecular Formula | C21H24FKO7 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | potassium;2-[(2R,3S,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid;hydride |
| SMILES | O=C(O)COC[C@@H](O)[C@@H](O)C=CC=CC#CC=C[C@@H](O)COc1ccc(F)cc1.[H-].[K+] |
| InChI | InChI=1S/C21H23FO7.K.H/c22-16-9-11-18(12-10-16)29-13-17(23)7-5-3-1-2-4-6-8-19(24)20(25)14-28-15-21(26)27;;/h2,4-12,17,19-20,23-25H,13-15H2,(H,26,27);;/q;+1;-1/t17-,19+,20-;;/m1../s1 |
| InChIKey | YSXKIZLGSQMGEZ-BMALREFQSA-N |
| XLogP | -1.82 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|