C24H29FO6 — CID 11235820
methyl (5S,7S,8E,10E,14E,16S)-17-(4-fluorophenoxy)-5,7,16-trihydroxyheptadeca-8,10,14-trien-12-ynoate (PubChem CID 11235820) has the molecular formula C24H29FO6 and a molecular weight of 432.49 g/mol. Its IUPAC name is methyl (5S,7S,8E,10E,14E,16S)-17-(4-fluorophenoxy)-5,7,16-trihydroxyheptadeca-8,10,14-trien-12-ynoate.
| Compound Name | methyl (5S,7S,8E,10E,14E,16S)-17-(4-fluorophenoxy)-5,7,16-trihydroxyheptadeca-8,10,14-trien-12-ynoate |
|---|---|
| PubChem CID | 11235820 |
| Molecular Formula | C24H29FO6 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | methyl (5S,7S,8E,10E,14E,16S)-17-(4-fluorophenoxy)-5,7,16-trihydroxyheptadeca-8,10,14-trien-12-ynoate |
| SMILES | COC(=O)CCC[C@H](O)C[C@H](O)/C=C/C=C/C#C/C=C/[C@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FO6/c1-30-24(29)12-8-11-21(27)17-20(26)9-6-4-2-3-5-7-10-22(28)18-31-23-15-13-19(25)14-16-23/h2,4,6-7,9-10,13-16,20-22,26-28H,8,11-12,17-18H2,1H3/b4-2+,9-6+,10-7+/t20-,21+,22+/m1/s1 |
| InChIKey | NKYXSHXQHKKSJS-KEQFDNMRSA-N |
| XLogP | 2.69 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|