C21H25FO4 — CID 75108497
ethyl 13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoate (PubChem CID 75108497) has the molecular formula C21H25FO4 and a molecular weight of 360.43 g/mol. Its IUPAC name is ethyl 13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoate.
| Compound Name | ethyl 13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoate |
|---|---|
| PubChem CID | 75108497 |
| Molecular Formula | C21H25FO4 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl 13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoate |
| SMILES | CCOC(=O)CCCC(O)C#CC=CC=CC(O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FO4/c1-2-26-21(25)11-7-10-19(23)8-5-3-4-6-9-20(24)16-17-12-14-18(22)15-13-17/h3-4,6,9,12-15,19-20,23-24H,2,7,10-11,16H2,1H3 |
| InChIKey | UVQQPNRVLOIFEY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|