C23H26O4 — CID 45275695
ethyl (5S,8E,10E,12R)-5,12-dihydroxy-15-phenylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 45275695) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is ethyl (5S,8E,10E,12R)-5,12-dihydroxy-15-phenylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | ethyl (5S,8E,10E,12R)-5,12-dihydroxy-15-phenylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 45275695 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl (5S,8E,10E,12R)-5,12-dihydroxy-15-phenylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | CCOC(=O)CCC[C@H](O)C#C/C=C/C=C/[C@H](O)CC#Cc1ccccc1 |
| InChI | InChI=1S/C23H26O4/c1-2-27-23(26)19-11-18-22(25)16-9-4-3-8-15-21(24)17-10-14-20-12-6-5-7-13-20/h3-8,12-13,15,21-22,24-25H,2,11,17-19H2,1H3/b4-3+,15-8+/t21-,22+/m0/s1 |
| InChIKey | NSSQEEKQYXDBCF-UIANLZDKSA-N |
| XLogP | 3.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|