C19H21FO4 — CID 46872409
(5R,8E,10E,12R)-13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoic acid (PubChem CID 46872409) has the molecular formula C19H21FO4 and a molecular weight of 332.37 g/mol. Its IUPAC name is (5R,8E,10E,12R)-13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoic acid.
| Compound Name | (5R,8E,10E,12R)-13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoic acid |
|---|---|
| PubChem CID | 46872409 |
| Molecular Formula | C19H21FO4 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (5R,8E,10E,12R)-13-(4-fluorophenyl)-5,12-dihydroxytrideca-8,10-dien-6-ynoic acid |
| SMILES | O=C(O)CCC[C@@H](O)C#C/C=C/C=C/[C@H](O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FO4/c20-16-12-10-15(11-13-16)14-18(22)7-4-2-1-3-6-17(21)8-5-9-19(23)24/h1-2,4,7,10-13,17-18,21-22H,5,8-9,14H2,(H,23,24)/b2-1+,7-4+/t17-,18-/m0/s1 |
| InChIKey | ZSFKNYOALSHFGH-RVFILOEOSA-N |
| XLogP | 2.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|