C16H20O3ReRf — CID 59003870
(6S,9E,11E,13R)-6,13-dihydroxyhexadeca-9,11-dien-7,15-diyn-2-one;rhenium;rutherfordium (PubChem CID 59003870) has the molecular formula C16H20O3ReRf and a molecular weight of 713.54 g/mol. Its IUPAC name is (6S,9E,11E,13R)-6,13-dihydroxyhexadeca-9,11-dien-7,15-diyn-2-one;rhenium;rutherfordium.
| Compound Name | (6S,9E,11E,13R)-6,13-dihydroxyhexadeca-9,11-dien-7,15-diyn-2-one;rhenium;rutherfordium |
|---|---|
| PubChem CID | 59003870 |
| Molecular Formula | C16H20O3ReRf |
| Molecular Weight | 713.54 g/mol |
| Exact Mass | 714.22 |
| IUPAC Name | (6S,9E,11E,13R)-6,13-dihydroxyhexadeca-9,11-dien-7,15-diyn-2-one;rhenium;rutherfordium |
| SMILES | C#CC[C@@H](O)/C=C/C=C/C#C[C@@H](O)CCCC(C)=O.[Re].[Rf] |
| InChI | InChI=1S/C16H20O3.Re.Rf/c1-3-9-15(18)11-6-4-5-7-12-16(19)13-8-10-14(2)17;;/h1,4-6,11,15-16,18-19H,8-10,13H2,2H3;;/b5-4+,11-6+;;/t15-,16-;;/m1../s1 |
| InChIKey | KTAIIFZZNVOPFL-XOISCVMOSA-N |
| XLogP | 1.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|