(5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid

C15H18O3 — CID 45275265

IUPAC(5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid
SMILESC#CCC/C=C/C=C/C#C[C@@H](O)CCCC(=O)O
InChIInChI=1S/C15H18O3/c1-2-3-4-5-6-7-8-9-11-14(16)12-10-13-15(17)18/h1,5-8,14,16H,3-4,10,12-13H2,(H,17,18)/b6-5+,8-7+/t14-/m1/s1
InChIKeySFYGSTIPSPXXPW-WXJWXOSTSA-N
MW246.31 g/mol
LogP2.13
Rot. Bonds7

About (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid

(5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid (PubChem CID 45275265) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid.

Molecular Properties

Compound Name(5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid
PubChem CID45275265
Molecular FormulaC15H18O3
Molecular Weight246.31 g/mol
Exact Mass246.13
IUPAC Name(5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid
SMILESC#CCC/C=C/C=C/C#C[C@@H](O)CCCC(=O)O
InChIInChI=1S/C15H18O3/c1-2-3-4-5-6-7-8-9-11-14(16)12-10-13-15(17)18/h1,5-8,14,16H,3-4,10,12-13H2,(H,17,18)/b6-5+,8-7+/t14-/m1/s1
InChIKeySFYGSTIPSPXXPW-WXJWXOSTSA-N
XLogP2.13
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.31
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid?
The IUPAC name of (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid (CID 45275265) is (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid.
What is the SMILES notation for (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid?
The canonical SMILES for (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid is C#CCC/C=C/C=C/C#C[C@@H](O)CCCC(=O)O.
What is the InChIKey of (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid?
The InChIKey is SFYGSTIPSPXXPW-WXJWXOSTSA-N. The full InChI is InChI=1S/C15H18O3/c1-2-3-4-5-6-7-8-9-11-14(16)12-10-13-15(17)18/h1,5-8,14,16H,3-4,10,12-13H2,(H,17,18)/b6-5+,8-7+/t14-/m1/s1.
What are the key properties of (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid?
(5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid has a molecular weight of 246.31 g/mol, XLogP of 2.13, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid is sourced from PubChem (CID 45275265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).