C15H18O3 — CID 45275265
(5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid (PubChem CID 45275265) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid.
| Compound Name | (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid |
|---|---|
| PubChem CID | 45275265 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (5S,8E,10E)-5-hydroxypentadeca-8,10-dien-6,14-diynoic acid |
| SMILES | C#CCC/C=C/C=C/C#C[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C15H18O3/c1-2-3-4-5-6-7-8-9-11-14(16)12-10-13-15(17)18/h1,5-8,14,16H,3-4,10,12-13H2,(H,17,18)/b6-5+,8-7+/t14-/m1/s1 |
| InChIKey | SFYGSTIPSPXXPW-WXJWXOSTSA-N |
| XLogP | 2.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|