C17H23NO4 — CID 163571161
ethylamino (5R,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate (PubChem CID 163571161) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is ethylamino (5R,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate.
| Compound Name | ethylamino (5R,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 163571161 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethylamino (5R,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate |
| SMILES | C#CC[C@@H](O)/C=C/C=C/C#C[C@H](O)CCCC(=O)ONCC |
| InChI | InChI=1S/C17H23NO4/c1-3-10-15(19)11-7-5-6-8-12-16(20)13-9-14-17(21)22-18-4-2/h1,5-7,11,15-16,18-20H,4,9-10,13-14H2,2H3/b6-5+,11-7+/t15-,16+/m1/s1 |
| InChIKey | FZLPUUQBIMOEPI-INJWLMGFSA-N |
| XLogP | 1.09 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|