C21H32O3Si — CID 58461641
ethyl (5S,8E,10E,12R)-5-hydroxy-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 58461641) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is ethyl (5S,8E,10E,12R)-5-hydroxy-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | ethyl (5S,8E,10E,12R)-5-hydroxy-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 58461641 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | ethyl (5S,8E,10E,12R)-5-hydroxy-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | CCOC(=O)CCC[C@H](O)C#C/C=C/C=C/[C@H](C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C21H32O3Si/c1-6-24-21(23)17-11-16-20(22)15-10-8-7-9-13-19(2)14-12-18-25(3,4)5/h7-9,13,19-20,22H,6,11,14,16-17H2,1-5H3/b8-7+,13-9+/t19-,20+/m0/s1 |
| InChIKey | BHBPBYTZYGYTNI-PHVYHKANSA-N |
| XLogP | 4.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|