C16H24O4 — CID 58373595
ethyl (5S,8E,10E,12R)-5,12-dihydroxytetradeca-8,10-dien-6-ynoate (PubChem CID 58373595) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl (5S,8E,10E,12R)-5,12-dihydroxytetradeca-8,10-dien-6-ynoate.
| Compound Name | ethyl (5S,8E,10E,12R)-5,12-dihydroxytetradeca-8,10-dien-6-ynoate |
|---|---|
| PubChem CID | 58373595 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl (5S,8E,10E,12R)-5,12-dihydroxytetradeca-8,10-dien-6-ynoate |
| SMILES | CCOC(=O)CCC[C@H](O)C#C/C=C/C=C/[C@H](O)CC |
| InChI | InChI=1S/C16H24O4/c1-3-14(17)10-7-5-6-8-11-15(18)12-9-13-16(19)20-4-2/h5-7,10,14-15,17-18H,3-4,9,12-13H2,1-2H3/b6-5+,10-7+/t14-,15-/m1/s1 |
| InChIKey | PHAHQVUEABMMLE-INUKKLBASA-N |
| XLogP | 1.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|