C28H54O4Si3 — CID 100980678
methyl (5S,6R,7E,9E)-5,6-bis(triethylsilyloxy)-12-trimethylsilyldodeca-7,9-dien-11-ynoate (PubChem CID 100980678) has the molecular formula C28H54O4Si3 and a molecular weight of 538.99 g/mol. Its IUPAC name is methyl (5S,6R,7E,9E)-5,6-bis(triethylsilyloxy)-12-trimethylsilyldodeca-7,9-dien-11-ynoate.
| Compound Name | methyl (5S,6R,7E,9E)-5,6-bis(triethylsilyloxy)-12-trimethylsilyldodeca-7,9-dien-11-ynoate |
|---|---|
| PubChem CID | 100980678 |
| Molecular Formula | C28H54O4Si3 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | methyl (5S,6R,7E,9E)-5,6-bis(triethylsilyloxy)-12-trimethylsilyldodeca-7,9-dien-11-ynoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCCC(=O)OC)[C@@H](/C=C/C=C/C#C[Si](C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H54O4Si3/c1-11-34(12-2,13-3)31-26(22-19-17-18-20-25-33(8,9)10)27(23-21-24-28(29)30-7)32-35(14-4,15-5)16-6/h17-19,22,26-27H,11-16,21,23-24H2,1-10H3/b18-17+,22-19+/t26-,27+/m1/s1 |
| InChIKey | ZGEYXSXHSRFTHO-QZLLEFKTSA-N |
| XLogP | 8.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|