C21H42O4Si2 — CID 154727870
methyl (5S,6R)-5,6-bis(triethylsilyloxy)oct-7-ynoate (PubChem CID 154727870) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is methyl (5S,6R)-5,6-bis(triethylsilyloxy)oct-7-ynoate.
| Compound Name | methyl (5S,6R)-5,6-bis(triethylsilyloxy)oct-7-ynoate |
|---|---|
| PubChem CID | 154727870 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | methyl (5S,6R)-5,6-bis(triethylsilyloxy)oct-7-ynoate |
| SMILES | C#C[C@@H](O[Si](CC)(CC)CC)[C@H](CCCC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H42O4Si2/c1-9-19(24-26(10-2,11-3)12-4)20(17-16-18-21(22)23-8)25-27(13-5,14-6)15-7/h1,19-20H,10-18H2,2-8H3/t19-,20+/m1/s1 |
| InChIKey | CZHUBLHLWQGQRM-UXHICEINSA-N |
| XLogP | 5.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|