C28H62O5Si3 — CID 140529967
methyl (4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 140529967) has the molecular formula C28H62O5Si3 and a molecular weight of 563.06 g/mol. Its IUPAC name is methyl (4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | methyl (4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 140529967 |
| Molecular Formula | C28H62O5Si3 |
| Molecular Weight | 563.06 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | methyl (4S,5R)-4,6-bis(triethylsilyloxy)-5-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | CC[Si](CC)(CC)OC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CCC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H62O5Si3/c1-14-34(15-2,16-3)31-22-27(33-36(23(7)8,24(9)10)25(11)12)26(20-21-28(29)30-13)32-35(17-4,18-5)19-6/h23-27H,14-22H2,1-13H3/t26-,27+/m0/s1 |
| InChIKey | DHRRLBRVARFJSR-RRPNLBNLSA-N |
| XLogP | 8.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.06 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|