C17H24O3 — CID 91347208
6,13-dihydroxy-8-methylidenehexadeca-9,11-dien-15-yn-2-one (PubChem CID 91347208) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 6,13-dihydroxy-8-methylidenehexadeca-9,11-dien-15-yn-2-one.
| Compound Name | 6,13-dihydroxy-8-methylidenehexadeca-9,11-dien-15-yn-2-one |
|---|---|
| PubChem CID | 91347208 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 6,13-dihydroxy-8-methylidenehexadeca-9,11-dien-15-yn-2-one |
| SMILES | C#CCC(O)C=CC=CC(=C)CC(O)CCCC(C)=O |
| InChI | InChI=1S/C17H24O3/c1-4-8-16(19)11-6-5-9-14(2)13-17(20)12-7-10-15(3)18/h1,5-6,9,11,16-17,19-20H,2,7-8,10,12-13H2,3H3 |
| InChIKey | AKFMKKCCNYBFOC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|