C14H20O3 — CID 158380827
8-prop-2-ynylundecane-2,6,9-trione (PubChem CID 158380827) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 8-prop-2-ynylundecane-2,6,9-trione.
| Compound Name | 8-prop-2-ynylundecane-2,6,9-trione |
|---|---|
| PubChem CID | 158380827 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 8-prop-2-ynylundecane-2,6,9-trione |
| SMILES | C#CCC(CC(=O)CCCC(C)=O)C(=O)CC |
| InChI | InChI=1S/C14H20O3/c1-4-7-12(14(17)5-2)10-13(16)9-6-8-11(3)15/h1,12H,5-10H2,2-3H3 |
| InChIKey | VGNHLDNECQODDP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|