About (6S,7R)-6,7-dihydroxynon-8-en-2-one
(6S,7R)-6,7-dihydroxynon-8-en-2-one (PubChem CID 59003863) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is (6S,7R)-6,7-dihydroxynon-8-en-2-one.
Molecular Properties
| Compound Name | (6S,7R)-6,7-dihydroxynon-8-en-2-one |
| PubChem CID | 59003863 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (6S,7R)-6,7-dihydroxynon-8-en-2-one |
| SMILES | C=C[C@@H](O)[C@@H](O)CCCC(C)=O |
| InChI | InChI=1S/C9H16O3/c1-3-8(11)9(12)6-4-5-7(2)10/h3,8-9,11-12H,1,4-6H2,2H3/t8-,9+/m1/s1 |
| InChIKey | MYKFITGGKRRZSM-BDAKNGLRSA-N |
| XLogP | 0.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S,7R)-6,7-dihydroxynon-8-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S,7R)-6,7-dihydroxynon-8-en-2-one?
The IUPAC name of (6S,7R)-6,7-dihydroxynon-8-en-2-one (CID 59003863) is (6S,7R)-6,7-dihydroxynon-8-en-2-one.
What is the SMILES notation for (6S,7R)-6,7-dihydroxynon-8-en-2-one?
The canonical SMILES for (6S,7R)-6,7-dihydroxynon-8-en-2-one is C=C[C@@H](O)[C@@H](O)CCCC(C)=O.
What is the InChIKey of (6S,7R)-6,7-dihydroxynon-8-en-2-one?
The InChIKey is MYKFITGGKRRZSM-BDAKNGLRSA-N. The full InChI is InChI=1S/C9H16O3/c1-3-8(11)9(12)6-4-5-7(2)10/h3,8-9,11-12H,1,4-6H2,2H3/t8-,9+/m1/s1.
What are the key properties of (6S,7R)-6,7-dihydroxynon-8-en-2-one?
(6S,7R)-6,7-dihydroxynon-8-en-2-one has a molecular weight of 172.22 g/mol, XLogP of 0.65, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,7R)-6,7-dihydroxynon-8-en-2-one is sourced from PubChem (CID 59003863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).