About 3-methyloctane-2,7-dione
3-methyloctane-2,7-dione (PubChem CID 13063377) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-methyloctane-2,7-dione.
Molecular Properties
| Compound Name | 3-methyloctane-2,7-dione |
| PubChem CID | 13063377 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-methyloctane-2,7-dione |
| SMILES | CC(=O)CCCC(C)C(C)=O |
| InChI | InChI=1S/C9H16O2/c1-7(9(3)11)5-4-6-8(2)10/h7H,4-6H2,1-3H3 |
| InChIKey | XAKNPTVPASRQNY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyloctane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloctane-2,7-dione?
The IUPAC name of 3-methyloctane-2,7-dione (CID 13063377) is 3-methyloctane-2,7-dione.
What is the SMILES notation for 3-methyloctane-2,7-dione?
The canonical SMILES for 3-methyloctane-2,7-dione is CC(=O)CCCC(C)C(C)=O.
What is the InChIKey of 3-methyloctane-2,7-dione?
The InChIKey is XAKNPTVPASRQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-7(9(3)11)5-4-6-8(2)10/h7H,4-6H2,1-3H3.
What are the key properties of 3-methyloctane-2,7-dione?
3-methyloctane-2,7-dione has a molecular weight of 156.22 g/mol, XLogP of 1.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloctane-2,7-dione is sourced from PubChem (CID 13063377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).