C15H26O3 — CID 162032629
3,11-dimethyltridecane-2,5,12-trione (PubChem CID 162032629) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3,11-dimethyltridecane-2,5,12-trione.
| Compound Name | 3,11-dimethyltridecane-2,5,12-trione |
|---|---|
| PubChem CID | 162032629 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3,11-dimethyltridecane-2,5,12-trione |
| SMILES | CC(=O)C(C)CCCCCC(=O)CC(C)C(C)=O |
| InChI | InChI=1S/C15H26O3/c1-11(13(3)16)8-6-5-7-9-15(18)10-12(2)14(4)17/h11-12H,5-10H2,1-4H3 |
| InChIKey | COWFIJQDUPPDQF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|