C17H34O4 — CID 54276574
15,16,17-trihydroxyheptadecan-2-one (PubChem CID 54276574) has the molecular formula C17H34O4 and a molecular weight of 302.46 g/mol. Its IUPAC name is 15,16,17-trihydroxyheptadecan-2-one.
| Compound Name | 15,16,17-trihydroxyheptadecan-2-one |
|---|---|
| PubChem CID | 54276574 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 15,16,17-trihydroxyheptadecan-2-one |
| SMILES | CC(=O)CCCCCCCCCCCCC(O)C(O)CO |
| InChI | InChI=1S/C17H34O4/c1-15(19)12-10-8-6-4-2-3-5-7-9-11-13-16(20)17(21)14-18/h16-18,20-21H,2-14H2,1H3 |
| InChIKey | RNVCEKFCQNLBBH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|