C7H14O4 — CID 139447202
(5S)-5,6,7-trihydroxyheptan-2-one (PubChem CID 139447202) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is (5S)-5,6,7-trihydroxyheptan-2-one.
| Compound Name | (5S)-5,6,7-trihydroxyheptan-2-one |
|---|---|
| PubChem CID | 139447202 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (5S)-5,6,7-trihydroxyheptan-2-one |
| SMILES | CC(=O)CC[C@H](O)C(O)CO |
| InChI | InChI=1S/C7H14O4/c1-5(9)2-3-6(10)7(11)4-8/h6-8,10-11H,2-4H2,1H3/t6-,7?/m0/s1 |
| InChIKey | OJIOHDWMBSHXLM-PKPIPKONSA-N |
| XLogP | -0.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |