C9H16O3 — CID 175277175
3-(1-hydroxyethyl)heptane-2,6-dione (PubChem CID 175277175) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)heptane-2,6-dione.
| Compound Name | 3-(1-hydroxyethyl)heptane-2,6-dione |
|---|---|
| PubChem CID | 175277175 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 3-(1-hydroxyethyl)heptane-2,6-dione |
| SMILES | CC(=O)CCC(C(C)=O)C(C)O |
| InChI | InChI=1S/C9H16O3/c1-6(10)4-5-9(7(2)11)8(3)12/h7,9,11H,4-5H2,1-3H3 |
| InChIKey | WRQRQXMMHOBNDS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |