C7H13IO2 — CID 102014025
(3R,4R)-4-hydroxy-3-(2-iodoethyl)pentan-2-one (PubChem CID 102014025) has the molecular formula C7H13IO2 and a molecular weight of 256.08 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-(2-iodoethyl)pentan-2-one.
| Compound Name | (3R,4R)-4-hydroxy-3-(2-iodoethyl)pentan-2-one |
|---|---|
| PubChem CID | 102014025 |
| Molecular Formula | C7H13IO2 |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-(2-iodoethyl)pentan-2-one |
| SMILES | CC(=O)C(CCI)[C@@H](C)O |
| InChI | InChI=1S/C7H13IO2/c1-5(9)7(3-4-8)6(2)10/h5,7,9H,3-4H2,1-2H3/t5-,7?/m1/s1 |
| InChIKey | JSZFUISCWCRFKB-FOUAAFFMSA-N |
| XLogP | 1.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|