C13H19NO3 — CID 89037705
amino (6E,8E,10R)-10-hydroxytrideca-6,8-dien-12-ynoate (PubChem CID 89037705) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is amino (6E,8E,10R)-10-hydroxytrideca-6,8-dien-12-ynoate.
| Compound Name | amino (6E,8E,10R)-10-hydroxytrideca-6,8-dien-12-ynoate |
|---|---|
| PubChem CID | 89037705 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | amino (6E,8E,10R)-10-hydroxytrideca-6,8-dien-12-ynoate |
| SMILES | C#CC[C@@H](O)/C=C/C=C/CCCCC(=O)ON |
| InChI | InChI=1S/C13H19NO3/c1-2-9-12(15)10-7-5-3-4-6-8-11-13(16)17-14/h1,3,5,7,10,12,15H,4,6,8-9,11,14H2/b5-3+,10-7+/t12-/m1/s1 |
| InChIKey | ZVQGCTFMKDQUSB-UJKLYGFZSA-N |
| XLogP | 1.46 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|