C25H40O6 — CID 123884402
2,3-dihydroxypropyl 11,13-dihydroxydocosa-7,9,14,16,19-pentaenoate (PubChem CID 123884402) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 11,13-dihydroxydocosa-7,9,14,16,19-pentaenoate.
| Compound Name | 2,3-dihydroxypropyl 11,13-dihydroxydocosa-7,9,14,16,19-pentaenoate |
|---|---|
| PubChem CID | 123884402 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2,3-dihydroxypropyl 11,13-dihydroxydocosa-7,9,14,16,19-pentaenoate |
| SMILES | CCC=CCC=CC=CC(O)CC(O)C=CC=CCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C25H40O6/c1-2-3-4-5-7-10-13-16-22(27)19-23(28)17-14-11-8-6-9-12-15-18-25(30)31-21-24(29)20-26/h3-4,7-8,10-11,13-14,16-17,22-24,26-29H,2,5-6,9,12,15,18-21H2,1H3 |
| InChIKey | YGZVGUVFXFVOQN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|