C25H40O6 — CID 118040687
2,3-dihydroxypropyl (8E,10Z,13Z,16Z,19Z)-7-hydroperoxydocosa-8,10,13,16,19-pentaenoate (PubChem CID 118040687) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (8E,10Z,13Z,16Z,19Z)-7-hydroperoxydocosa-8,10,13,16,19-pentaenoate.
| Compound Name | 2,3-dihydroxypropyl (8E,10Z,13Z,16Z,19Z)-7-hydroperoxydocosa-8,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 118040687 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2,3-dihydroxypropyl (8E,10Z,13Z,16Z,19Z)-7-hydroperoxydocosa-8,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(CCCCCC(=O)OCC(O)CO)OO |
| InChI | InChI=1S/C25H40O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-24(31-29)19-16-14-17-20-25(28)30-22-23(27)21-26/h3-4,6-7,9-10,12-13,15,18,23-24,26-27,29H,2,5,8,11,14,16-17,19-22H2,1H3/b4-3-,7-6-,10-9-,13-12-,18-15+ |
| InChIKey | INDIWYDDZRRBRB-FHMCMKDHSA-N |
| XLogP | 5.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|