C21H23FO7 — CID 24858275
2-[(2S,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid (PubChem CID 24858275) has the molecular formula C21H23FO7 and a molecular weight of 406.41 g/mol. Its IUPAC name is 2-[(2S,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid.
| Compound Name | 2-[(2S,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid |
|---|---|
| PubChem CID | 24858275 |
| Molecular Formula | C21H23FO7 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[(2S,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetic acid |
| SMILES | O=C(O)COC[C@H](O)[C@@H](O)/C=C/C=C/C#C/C=C/[C@@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FO7/c22-16-9-11-18(12-10-16)29-13-17(23)7-5-3-1-2-4-6-8-19(24)20(25)14-28-15-21(26)27/h2,4-12,17,19-20,23-25H,13-15H2,(H,26,27)/b4-2+,7-5+,8-6+/t17-,19+,20+/m1/s1 |
| InChIKey | HLADOSSHOHRFMH-HVDLERLASA-N |
| XLogP | 1.06 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|