C21H22FKO7 — CID 24858270
potassium 2-[(2R,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate (PubChem CID 24858270) has the molecular formula C21H22FKO7 and a molecular weight of 444.50 g/mol. Its IUPAC name is potassium 2-[(2R,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate.
| Compound Name | potassium 2-[(2R,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate |
|---|---|
| PubChem CID | 24858270 |
| Molecular Formula | C21H22FKO7 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | potassium 2-[(2R,3S,4E,6E,10E,12R)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,10-trien-8-ynoxy]acetate |
| SMILES | O=C([O-])COC[C@@H](O)[C@@H](O)/C=C/C=C/C#C/C=C/[C@@H](O)COc1ccc(F)cc1.[K+] |
| InChI | InChI=1S/C21H23FO7.K/c22-16-9-11-18(12-10-16)29-13-17(23)7-5-3-1-2-4-6-8-19(24)20(25)14-28-15-21(26)27;/h2,4-12,17,19-20,23-25H,13-15H2,(H,26,27);/q;+1/p-1/b4-2+,7-5+,8-6+;/t17-,19+,20-;/m1./s1 |
| InChIKey | SSNGRCVTRMPEKF-KYPWTZCQSA-M |
| XLogP | -3.27 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|