C21H24FNaO7 — CID 23676103
sodium 2-[(2S,3R,4E,6E,8Z,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetate (PubChem CID 23676103) has the molecular formula C21H24FNaO7 and a molecular weight of 430.40 g/mol. Its IUPAC name is sodium 2-[(2S,3R,4E,6E,8Z,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetate.
| Compound Name | sodium 2-[(2S,3R,4E,6E,8Z,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetate |
|---|---|
| PubChem CID | 23676103 |
| Molecular Formula | C21H24FNaO7 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | sodium 2-[(2S,3R,4E,6E,8Z,10E,12S)-13-(4-fluorophenoxy)-2,3,12-trihydroxytrideca-4,6,8,10-tetraenoxy]acetate |
| SMILES | O=C([O-])COC[C@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@H](O)COc1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C21H25FO7.Na/c22-16-9-11-18(12-10-16)29-13-17(23)7-5-3-1-2-4-6-8-19(24)20(25)14-28-15-21(26)27;/h1-12,17,19-20,23-25H,13-15H2,(H,26,27);/q;+1/p-1/b3-1-,4-2+,7-5+,8-6+;/t17-,19+,20-;/m0./s1 |
| InChIKey | CBYQEWRVJGNMBR-DUDHREEWSA-M |
| XLogP | -2.72 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|