C35H50O6 — CID 174557050
dioctyl benzene-1,2-dicarboxylate;5-phenoxypent-1-en-3-one (PubChem CID 174557050) has the molecular formula C35H50O6 and a molecular weight of 566.78 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;5-phenoxypent-1-en-3-one.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;5-phenoxypent-1-en-3-one |
|---|---|
| PubChem CID | 174557050 |
| Molecular Formula | C35H50O6 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;5-phenoxypent-1-en-3-one |
| SMILES | C=CC(=O)CCOc1ccccc1.CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC |
| InChI | InChI=1S/C24H38O4.C11H12O2/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;1-2-10(12)8-9-13-11-6-4-3-5-7-11/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;2-7H,1,8-9H2 |
| InChIKey | UFDURYBYDBCLGA-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|