C25H44O8Si2 — CID 134943675
methyl 3-[(6R,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dihydroxy-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-yl]prop-2-ynoate (PubChem CID 134943675) has the molecular formula C25H44O8Si2 and a molecular weight of 528.79 g/mol. Its IUPAC name is methyl 3-[(6R,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dihydroxy-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-yl]prop-2-ynoate.
| Compound Name | methyl 3-[(6R,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dihydroxy-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 134943675 |
| Molecular Formula | C25H44O8Si2 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | methyl 3-[(6R,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dihydroxy-7-triethylsilyloxy-1,4-dioxaspiro[4.5]dec-9-en-6-yl]prop-2-ynoate |
| SMILES | CC[Si](CC)(CC)O[C@]1(CO[Si](C)(C)C(C)(C)C)[C@H](O)C=CC2(OCCO2)[C@@]1(O)C#CC(=O)OC |
| InChI | InChI=1S/C25H44O8Si2/c1-10-35(11-2,12-3)33-23(19-32-34(8,9)22(4,5)6)20(26)13-16-25(30-17-18-31-25)24(23,28)15-14-21(27)29-7/h13,16,20,26,28H,10-12,17-19H2,1-9H3/t20-,23-,24-/m1/s1 |
| InChIKey | VCDGCIQCODKLFS-AGILITTLSA-N |
| XLogP | 3.35 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|