C23H40O5Si2 — CID 44556779
(2R)-2-[(E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-3-methyl-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one (PubChem CID 44556779) has the molecular formula C23H40O5Si2 and a molecular weight of 452.74 g/mol. Its IUPAC name is (2R)-2-[(E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-3-methyl-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-3-methyl-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 44556779 |
| Molecular Formula | C23H40O5Si2 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (2R)-2-[(E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-3-methyl-8-trimethylsilyloct-1-en-7-ynyl]-2,3-dihydropyran-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C#C[Si](C)(C)C)C[C@@H](O)[C@](C)(O)/C=C/[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C23H40O5Si2/c1-22(2,3)30(8,9)28-19(14-16-29(5,6)7)17-20(24)23(4,26)15-13-18-11-10-12-21(25)27-18/h10,12-13,15,18-20,24,26H,11,17H2,1-9H3/b15-13+/t18-,19+,20-,23-/m1/s1 |
| InChIKey | JBZCPFQWNBPXJR-ZKIQIYNKSA-N |
| XLogP | 4.19 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|