C26H43IO6Si — CID 25135414
(2S,3S)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 25135414) has the molecular formula C26H43IO6Si and a molecular weight of 606.61 g/mol. Its IUPAC name is (2S,3S)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 25135414 |
| Molecular Formula | C26H43IO6Si |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | (2S,3S)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-4-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CC[C@H]1C=CC(=O)O[C@H]1/C=C/[C@@]1(CCO)OC(C)(C)O[C@@H]1C[C@H](/C=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H43IO6Si/c1-9-19-10-11-23(29)30-21(19)12-14-26(15-17-28)22(31-25(5,6)33-26)18-20(13-16-27)32-34(7,8)24(2,3)4/h10-14,16,19-22,28H,9,15,17-18H2,1-8H3/b14-12+,16-13-/t19-,20-,21-,22+,26-/m0/s1 |
| InChIKey | SSISGNUCMWZKSZ-NELRVDJTSA-N |
| XLogP | 6.05 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|