C22H42O5Si — CID 11177477
methyl (Z,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-tri(propan-2-yl)silyloxyhept-2-enoate (PubChem CID 11177477) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is methyl (Z,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-tri(propan-2-yl)silyloxyhept-2-enoate.
| Compound Name | methyl (Z,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-tri(propan-2-yl)silyloxyhept-2-enoate |
|---|---|
| PubChem CID | 11177477 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl (Z,5S,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-tri(propan-2-yl)silyloxyhept-2-enoate |
| SMILES | COC(=O)/C=C\C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H42O5Si/c1-15(2)28(16(3)4,17(5)6)27-19(12-11-13-21(23)24-10)18(7)20-14-25-22(8,9)26-20/h11,13,15-20H,12,14H2,1-10H3/b13-11-/t18-,19+,20+/m1/s1 |
| InChIKey | GENPRYRDBOXJFA-SXDBYMRMSA-N |
| XLogP | 5.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|