C26H47IO5Si2 — CID 11354078
(2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-iodo-3-methyl-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one (PubChem CID 11354078) has the molecular formula C26H47IO5Si2 and a molecular weight of 622.73 g/mol. Its IUPAC name is (2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-iodo-3-methyl-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-iodo-3-methyl-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11354078 |
| Molecular Formula | C26H47IO5Si2 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | (2R)-2-[(1E,3R,4R,6R,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-8-iodo-3-methyl-3-triethylsilyloxyocta-1,7-dienyl]-2,3-dihydropyran-6-one |
| SMILES | CC[Si](CC)(CC)O[C@](C)(/C=C/[C@H]1CC=CC(=O)O1)[C@H](O)C[C@H](/C=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H47IO5Si2/c1-10-34(11-2,12-3)32-26(7,18-16-21-14-13-15-24(29)30-21)23(28)20-22(17-19-27)31-33(8,9)25(4,5)6/h13,15-19,21-23,28H,10-12,14,20H2,1-9H3/b18-16+,19-17-/t21-,22+,23-,26-/m1/s1 |
| InChIKey | CLNPFJYXHBMHBT-OAOKAQSFSA-N |
| XLogP | 7.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|