C23H48O5Si2 — CID 86594392
ethyl (4R,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-4-methyloct-2-enoate (PubChem CID 86594392) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is ethyl (4R,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-4-methyloct-2-enoate.
| Compound Name | ethyl (4R,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-4-methyloct-2-enoate |
|---|---|
| PubChem CID | 86594392 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | ethyl (4R,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-4-methyloct-2-enoate |
| SMILES | CCOC(=O)C=C[C@@H](C)[C@H](C[C@@H](CO)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O5Si2/c1-13-26-21(25)15-14-18(2)20(28-30(11,12)23(6,7)8)16-19(17-24)27-29(9,10)22(3,4)5/h14-15,18-20,24H,13,16-17H2,1-12H3/t18-,19+,20+/m1/s1 |
| InChIKey | XIQIOGMEWJSUQC-AABGKKOBSA-N |
| XLogP | 5.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|