C16H32O4Si — CID 25170254
methyl (E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,6-dimethylhept-2-enoate (PubChem CID 25170254) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is methyl (E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,6-dimethylhept-2-enoate.
| Compound Name | methyl (E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,6-dimethylhept-2-enoate |
|---|---|
| PubChem CID | 25170254 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | methyl (E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,6-dimethylhept-2-enoate |
| SMILES | COC(=O)/C=C/C[C@@H](O)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-15(2,3)21(7,8)20-12-16(4,5)13(17)10-9-11-14(18)19-6/h9,11,13,17H,10,12H2,1-8H3/b11-9+/t13-/m1/s1 |
| InChIKey | LHQUDCLNYBZNAM-YGNAEDSMSA-N |
| XLogP | 3.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|