C23H37IO5Si — CID 11157068
(2R)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one (PubChem CID 11157068) has the molecular formula C23H37IO5Si and a molecular weight of 548.53 g/mol. Its IUPAC name is (2R)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11157068 |
| Molecular Formula | C23H37IO5Si |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (2R)-2-[(E)-2-[(4R,5R)-5-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-iodobut-3-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethenyl]-2,3-dihydropyran-6-one |
| SMILES | CC1(C)O[C@H](C[C@H](/C=C\I)O[Si](C)(C)C(C)(C)C)[C@@](C)(/C=C/[C@H]2CC=CC(=O)O2)O1 |
| InChI | InChI=1S/C23H37IO5Si/c1-21(2,3)30(7,8)28-18(13-15-24)16-19-23(6,29-22(4,5)27-19)14-12-17-10-9-11-20(25)26-17/h9,11-15,17-19H,10,16H2,1-8H3/b14-12+,15-13-/t17-,18+,19-,23-/m1/s1 |
| InChIKey | SALDQOVUEJGLPO-NHWUVVLVSA-N |
| XLogP | 6.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|