C21H28O5 — CID 74438088
2-(4,6,8-trihydroxy-10-phenyldec-1-enyl)-2,3-dihydropyran-6-one (PubChem CID 74438088) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-(4,6,8-trihydroxy-10-phenyldec-1-enyl)-2,3-dihydropyran-6-one.
| Compound Name | 2-(4,6,8-trihydroxy-10-phenyldec-1-enyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 74438088 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-(4,6,8-trihydroxy-10-phenyldec-1-enyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC(C=CCC(O)CC(O)CC(O)CCc2ccccc2)O1 |
| InChI | InChI=1S/C21H28O5/c22-17(8-4-9-20-10-5-11-21(25)26-20)14-19(24)15-18(23)13-12-16-6-2-1-3-7-16/h1-7,9,11,17-20,22-24H,8,10,12-15H2 |
| InChIKey | YZNUQTVBWSAEBN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|