C17H22O5 — CID 134970390
(2S)-2-[(2R)-2-[3-(3,4-dihydroxyphenyl)propoxy]propyl]-2,3-dihydropyran-6-one (PubChem CID 134970390) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-[3-(3,4-dihydroxyphenyl)propoxy]propyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(2R)-2-[3-(3,4-dihydroxyphenyl)propoxy]propyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 134970390 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2S)-2-[(2R)-2-[3-(3,4-dihydroxyphenyl)propoxy]propyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@H](C[C@@H]1CC=CC(=O)O1)OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H22O5/c1-12(10-14-5-2-6-17(20)22-14)21-9-3-4-13-7-8-15(18)16(19)11-13/h2,6-8,11-12,14,18-19H,3-5,9-10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | MZNKYGYYLXCZEQ-OCCSQVGLSA-N |
| XLogP | 2.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|