C21H22O8 — CID 74941383
[1-[2-[hydroxy-(6-oxo-2,3-dihydropyran-2-yl)methyl]cyclopropyl]-1-oxopropan-2-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 74941383) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is [1-[2-[hydroxy-(6-oxo-2,3-dihydropyran-2-yl)methyl]cyclopropyl]-1-oxopropan-2-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [1-[2-[hydroxy-(6-oxo-2,3-dihydropyran-2-yl)methyl]cyclopropyl]-1-oxopropan-2-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 74941383 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [1-[2-[hydroxy-(6-oxo-2,3-dihydropyran-2-yl)methyl]cyclopropyl]-1-oxopropan-2-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccc(O)c(O)c1)C(=O)C1CC1C(O)C1CC=CC(=O)O1 |
| InChI | InChI=1S/C21H22O8/c1-11(28-19(25)8-6-12-5-7-15(22)16(23)9-12)20(26)13-10-14(13)21(27)17-3-2-4-18(24)29-17/h2,4-9,11,13-14,17,21-23,27H,3,10H2,1H3 |
| InChIKey | PMVFYHVSZOZDAN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|