C11H13NO3 — CID 45093038
3-[2-(3,4-dihydroxyphenyl)ethylimino]propanal (PubChem CID 45093038) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-[2-(3,4-dihydroxyphenyl)ethylimino]propanal.
| Compound Name | 3-[2-(3,4-dihydroxyphenyl)ethylimino]propanal |
|---|---|
| PubChem CID | 45093038 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3-[2-(3,4-dihydroxyphenyl)ethylimino]propanal |
| SMILES | O=CC/C=N/CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H13NO3/c13-7-1-5-12-6-4-9-2-3-10(14)11(15)8-9/h2-3,5,7-8,14-15H,1,4,6H2/b12-5+ |
| InChIKey | FZPSVRYJDPYKHK-LFYBBSHMSA-N |
| XLogP | 1.30 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|