C19H26O4 — CID 11461301
(2S)-2-[(2R)-2-(methoxymethoxy)-6-phenylhexyl]-2,3-dihydropyran-6-one (PubChem CID 11461301) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-(methoxymethoxy)-6-phenylhexyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(2R)-2-(methoxymethoxy)-6-phenylhexyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11461301 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2S)-2-[(2R)-2-(methoxymethoxy)-6-phenylhexyl]-2,3-dihydropyran-6-one |
| SMILES | COCO[C@H](CCCCc1ccccc1)C[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C19H26O4/c1-21-15-22-17(14-18-12-7-13-19(20)23-18)11-6-5-10-16-8-3-2-4-9-16/h2-4,7-9,13,17-18H,5-6,10-12,14-15H2,1H3/t17-,18+/m1/s1 |
| InChIKey | ZXLTYMUODKJIFU-MSOLQXFVSA-N |
| XLogP | 3.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|